C16H13Cl2N5 — CID 19147893
4-N,6-N-bis(2-chlorophenyl)pyrimidine-4,5,6-triamine (PubChem CID 19147893) has the molecular formula C16H13Cl2N5 and a molecular weight of 346.22 g/mol. Its IUPAC name is 4-N,6-N-bis(2-chlorophenyl)pyrimidine-4,5,6-triamine.
| Compound Name | 4-N,6-N-bis(2-chlorophenyl)pyrimidine-4,5,6-triamine |
|---|---|
| PubChem CID | 19147893 |
| Molecular Formula | C16H13Cl2N5 |
| Molecular Weight | 346.22 g/mol |
| Exact Mass | 345.05 |
| IUPAC Name | 4-N,6-N-bis(2-chlorophenyl)pyrimidine-4,5,6-triamine |
| SMILES | Nc1c(Nc2ccccc2Cl)ncnc1Nc1ccccc1Cl |
| InChI | InChI=1S/C16H13Cl2N5/c17-10-5-1-3-7-12(10)22-15-14(19)16(21-9-20-15)23-13-8-4-2-6-11(13)18/h1-9H,19H2,(H2,20,21,22,23) |
| InChIKey | UNMAWILRSVQQIG-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 75.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.22 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |