C12H7F6N3 — CID 106747202
6-(trifluoromethyl)-4-N-(2,3,4-trifluorophenyl)pyridine-3,4-diamine (PubChem CID 106747202) has the molecular formula C12H7F6N3 and a molecular weight of 307.20 g/mol. Its IUPAC name is 6-(trifluoromethyl)-4-N-(2,3,4-trifluorophenyl)pyridine-3,4-diamine.
| Compound Name | 6-(trifluoromethyl)-4-N-(2,3,4-trifluorophenyl)pyridine-3,4-diamine |
|---|---|
| PubChem CID | 106747202 |
| Molecular Formula | C12H7F6N3 |
| Molecular Weight | 307.20 g/mol |
| Exact Mass | 307.05 |
| IUPAC Name | 6-(trifluoromethyl)-4-N-(2,3,4-trifluorophenyl)pyridine-3,4-diamine |
| SMILES | Nc1cnc(C(F)(F)F)cc1Nc1ccc(F)c(F)c1F |
| InChI | InChI=1S/C12H7F6N3/c13-5-1-2-7(11(15)10(5)14)21-8-3-9(12(16,17)18)20-4-6(8)19/h1-4H,19H2,(H,20,21) |
| InChIKey | GSPVNPIVFSFCKP-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.20 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|