C13H10F3N3O2 — CID 106747183
4-N-(1,3-benzodioxol-5-yl)-6-(trifluoromethyl)pyridine-3,4-diamine (PubChem CID 106747183) has the molecular formula C13H10F3N3O2 and a molecular weight of 297.24 g/mol. Its IUPAC name is 4-N-(1,3-benzodioxol-5-yl)-6-(trifluoromethyl)pyridine-3,4-diamine.
| Compound Name | 4-N-(1,3-benzodioxol-5-yl)-6-(trifluoromethyl)pyridine-3,4-diamine |
|---|---|
| PubChem CID | 106747183 |
| Molecular Formula | C13H10F3N3O2 |
| Molecular Weight | 297.24 g/mol |
| Exact Mass | 297.07 |
| IUPAC Name | 4-N-(1,3-benzodioxol-5-yl)-6-(trifluoromethyl)pyridine-3,4-diamine |
| SMILES | Nc1cnc(C(F)(F)F)cc1Nc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C13H10F3N3O2/c14-13(15,16)12-4-9(8(17)5-18-12)19-7-1-2-10-11(3-7)21-6-20-10/h1-5H,6,17H2,(H,18,19) |
| InChIKey | RLAZDNOALUYVBV-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 69.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.24 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |