C14H10F3NO2 — CID 154715537
5-(1,3-benzodioxol-5-ylmethyl)-2-(trifluoromethyl)pyridine (PubChem CID 154715537) has the molecular formula C14H10F3NO2 and a molecular weight of 281.23 g/mol. Its IUPAC name is 5-(1,3-benzodioxol-5-ylmethyl)-2-(trifluoromethyl)pyridine.
| Compound Name | 5-(1,3-benzodioxol-5-ylmethyl)-2-(trifluoromethyl)pyridine |
|---|---|
| PubChem CID | 154715537 |
| Molecular Formula | C14H10F3NO2 |
| Molecular Weight | 281.23 g/mol |
| Exact Mass | 281.07 |
| IUPAC Name | 5-(1,3-benzodioxol-5-ylmethyl)-2-(trifluoromethyl)pyridine |
| SMILES | FC(F)(F)c1ccc(Cc2ccc3c(c2)OCO3)cn1 |
| InChI | InChI=1S/C14H10F3NO2/c15-14(16,17)13-4-2-10(7-18-13)5-9-1-3-11-12(6-9)20-8-19-11/h1-4,6-7H,5,8H2 |
| InChIKey | BRCCMFZQDKKVBU-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 31.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.23 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |