C10H7F2NO2 — CID 141416799
3-(1,3-benzodioxol-5-yl)-2,2-difluoropropanenitrile (PubChem CID 141416799) has the molecular formula C10H7F2NO2 and a molecular weight of 211.17 g/mol. Its IUPAC name is 3-(1,3-benzodioxol-5-yl)-2,2-difluoropropanenitrile.
| Compound Name | 3-(1,3-benzodioxol-5-yl)-2,2-difluoropropanenitrile |
|---|---|
| PubChem CID | 141416799 |
| Molecular Formula | C10H7F2NO2 |
| Molecular Weight | 211.17 g/mol |
| Exact Mass | 211.04 |
| IUPAC Name | 3-(1,3-benzodioxol-5-yl)-2,2-difluoropropanenitrile |
| SMILES | N#CC(F)(F)Cc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C10H7F2NO2/c11-10(12,5-13)4-7-1-2-8-9(3-7)15-6-14-8/h1-3H,4,6H2 |
| InChIKey | NZHZCXFBZHOUMA-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 42.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.17 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |