C12H8Cl3N3O2 — CID 68951760
4-(1,3-benzodioxol-5-ylmethyl)-6-(trichloromethyl)triazine (PubChem CID 68951760) has the molecular formula C12H8Cl3N3O2 and a molecular weight of 332.57 g/mol. Its IUPAC name is 4-(1,3-benzodioxol-5-ylmethyl)-6-(trichloromethyl)triazine.
| Compound Name | 4-(1,3-benzodioxol-5-ylmethyl)-6-(trichloromethyl)triazine |
|---|---|
| PubChem CID | 68951760 |
| Molecular Formula | C12H8Cl3N3O2 |
| Molecular Weight | 332.57 g/mol |
| Exact Mass | 330.97 |
| IUPAC Name | 4-(1,3-benzodioxol-5-ylmethyl)-6-(trichloromethyl)triazine |
| SMILES | ClC(Cl)(Cl)c1cc(Cc2ccc3c(c2)OCO3)nnn1 |
| InChI | InChI=1S/C12H8Cl3N3O2/c13-12(14,15)11-5-8(16-18-17-11)3-7-1-2-9-10(4-7)20-6-19-9/h1-2,4-5H,3,6H2 |
| InChIKey | PVWZRKVYHIWFHS-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 57.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.57 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|