C11H10Cl4O2 — CID 12867442
5-(2,4,4,4-tetrachlorobutyl)-1,3-benzodioxole (PubChem CID 12867442) has the molecular formula C11H10Cl4O2 and a molecular weight of 316.01 g/mol. Its IUPAC name is 5-(2,4,4,4-tetrachlorobutyl)-1,3-benzodioxole.
| Compound Name | 5-(2,4,4,4-tetrachlorobutyl)-1,3-benzodioxole |
|---|---|
| PubChem CID | 12867442 |
| Molecular Formula | C11H10Cl4O2 |
| Molecular Weight | 316.01 g/mol |
| Exact Mass | 313.94 |
| IUPAC Name | 5-(2,4,4,4-tetrachlorobutyl)-1,3-benzodioxole |
| SMILES | ClC(Cc1ccc2c(c1)OCO2)CC(Cl)(Cl)Cl |
| InChI | InChI=1S/C11H10Cl4O2/c12-8(5-11(13,14)15)3-7-1-2-9-10(4-7)17-6-16-9/h1-2,4,8H,3,5-6H2 |
| InChIKey | MLUFGDZJKOKHJM-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.01 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|