C26H14Cl12N6O4 — CID 158509577
2-(1,3-benzodioxol-5-ylmethyl)-4,6-bis(trichloromethyl)-1,3,5-triazine (PubChem CID 158509577) has the molecular formula C26H14Cl12N6O4 and a molecular weight of 899.87 g/mol. Its IUPAC name is 2-(1,3-benzodioxol-5-ylmethyl)-4,6-bis(trichloromethyl)-1,3,5-triazine.
| Compound Name | 2-(1,3-benzodioxol-5-ylmethyl)-4,6-bis(trichloromethyl)-1,3,5-triazine |
|---|---|
| PubChem CID | 158509577 |
| Molecular Formula | C26H14Cl12N6O4 |
| Molecular Weight | 899.87 g/mol |
| Exact Mass | 893.73 |
| IUPAC Name | 2-(1,3-benzodioxol-5-ylmethyl)-4,6-bis(trichloromethyl)-1,3,5-triazine |
| SMILES | ClC(Cl)(Cl)c1nc(Cc2ccc3c(c2)OCO3)nc(C(Cl)(Cl)Cl)n1.ClC(Cl)(Cl)c1nc(Cc2ccc3c(c2)OCO3)nc(C(Cl)(Cl)Cl)n1 |
| InChI | InChI=1S/2C13H7Cl6N3O2/c2*14-12(15,16)10-20-9(21-11(22-10)13(17,18)19)4-6-1-2-7-8(3-6)24-5-23-7/h2*1-3H,4-5H2 |
| InChIKey | HKWREKMLRAQAPR-UHFFFAOYSA-N |
| XLogP | 9.69 |
| TPSA | 114.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 899.87 |
| LogP ≤ 5 | 9.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|