C13H14O3 — CID 672503
(3R)-5-(1,3-benzodioxol-5-yl)-3-methylpent-1-yn-3-ol (PubChem CID 672503) has the molecular formula C13H14O3 and a molecular weight of 218.25 g/mol. Its IUPAC name is (3R)-5-(1,3-benzodioxol-5-yl)-3-methylpent-1-yn-3-ol.
| Compound Name | (3R)-5-(1,3-benzodioxol-5-yl)-3-methylpent-1-yn-3-ol |
|---|---|
| PubChem CID | 672503 |
| Molecular Formula | C13H14O3 |
| Molecular Weight | 218.25 g/mol |
| Exact Mass | 218.09 |
| IUPAC Name | (3R)-5-(1,3-benzodioxol-5-yl)-3-methylpent-1-yn-3-ol |
| SMILES | C#C[C@](C)(O)CCc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C13H14O3/c1-3-13(2,14)7-6-10-4-5-11-12(8-10)16-9-15-11/h1,4-5,8,14H,6-7,9H2,2H3/t13-/m0/s1 |
| InChIKey | UNPRNWNZUHAPPW-ZDUSSCGKSA-N |
| XLogP | 1.73 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.25 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|