C14H18O5 — CID 55047904
ethyl 4-(1,3-benzodioxol-5-yl)-2-hydroxy-2-methylbutanoate (PubChem CID 55047904) has the molecular formula C14H18O5 and a molecular weight of 266.29 g/mol. Its IUPAC name is ethyl 4-(1,3-benzodioxol-5-yl)-2-hydroxy-2-methylbutanoate.
| Compound Name | ethyl 4-(1,3-benzodioxol-5-yl)-2-hydroxy-2-methylbutanoate |
|---|---|
| PubChem CID | 55047904 |
| Molecular Formula | C14H18O5 |
| Molecular Weight | 266.29 g/mol |
| Exact Mass | 266.12 |
| IUPAC Name | ethyl 4-(1,3-benzodioxol-5-yl)-2-hydroxy-2-methylbutanoate |
| SMILES | CCOC(=O)C(C)(O)CCc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C14H18O5/c1-3-17-13(15)14(2,16)7-6-10-4-5-11-12(8-10)19-9-18-11/h4-5,8,16H,3,6-7,9H2,1-2H3 |
| InChIKey | AIPZUPRLAYHKPN-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.29 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |