C24H20Br6Cl6N6O2 — CID 146547677
2-(1,3-benzodioxol-5-yl)-4,6-bis(trichloromethyl)-1,3,5-triazine;2,4,6-tris(1,3-dibromopropyl)-1,3,5-triazine (PubChem CID 146547677) has the molecular formula C24H20Br6Cl6N6O2 and a molecular weight of 1116.61 g/mol. Its IUPAC name is 2-(1,3-benzodioxol-5-yl)-4,6-bis(trichloromethyl)-1,3,5-triazine;2,4,6-tris(1,3-dibromopropyl)-1,3,5-triazine.
| Compound Name | 2-(1,3-benzodioxol-5-yl)-4,6-bis(trichloromethyl)-1,3,5-triazine;2,4,6-tris(1,3-dibromopropyl)-1,3,5-triazine |
|---|---|
| PubChem CID | 146547677 |
| Molecular Formula | C24H20Br6Cl6N6O2 |
| Molecular Weight | 1116.61 g/mol |
| Exact Mass | 1107.49 |
| IUPAC Name | 2-(1,3-benzodioxol-5-yl)-4,6-bis(trichloromethyl)-1,3,5-triazine;2,4,6-tris(1,3-dibromopropyl)-1,3,5-triazine |
| SMILES | BrCCC(Br)c1nc(C(Br)CCBr)nc(C(Br)CCBr)n1.ClC(Cl)(Cl)c1nc(-c2ccc3c(c2)OCO3)nc(C(Cl)(Cl)Cl)n1 |
| InChI | InChI=1S/C12H15Br6N3.C12H5Cl6N3O2/c13-4-1-7(16)10-19-11(8(17)2-5-14)21-12(20-10)9(18)3-6-15;13-11(14,15)9-19-8(20-10(21-9)12(16,17)18)5-1-2-6-7(3-5)23-4-22-6/h7-9H,1-6H2;1-3H,4H2 |
| InChIKey | MECRGZVWQOXUBD-UHFFFAOYSA-N |
| XLogP | 11.46 |
| TPSA | 95.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1116.61 |
| LogP ≤ 5 | 11.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|