C12H11N3O2 — CID 68985964
4-(1,3-benzodioxol-5-ylmethyl)-5-methyltriazine (PubChem CID 68985964) has the molecular formula C12H11N3O2 and a molecular weight of 229.24 g/mol. Its IUPAC name is 4-(1,3-benzodioxol-5-ylmethyl)-5-methyltriazine.
| Compound Name | 4-(1,3-benzodioxol-5-ylmethyl)-5-methyltriazine |
|---|---|
| PubChem CID | 68985964 |
| Molecular Formula | C12H11N3O2 |
| Molecular Weight | 229.24 g/mol |
| Exact Mass | 229.09 |
| IUPAC Name | 4-(1,3-benzodioxol-5-ylmethyl)-5-methyltriazine |
| SMILES | Cc1cnnnc1Cc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C12H11N3O2/c1-8-6-13-15-14-10(8)4-9-2-3-11-12(5-9)17-7-16-11/h2-3,5-6H,4,7H2,1H3 |
| InChIKey | FXRPLTDFJJXGFQ-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 57.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.24 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |