C15H13FO2 — CID 153168719
5-[(3-fluoro-4-methylphenyl)methyl]-1,3-benzodioxole (PubChem CID 153168719) has the molecular formula C15H13FO2 and a molecular weight of 244.26 g/mol. Its IUPAC name is 5-[(3-fluoro-4-methylphenyl)methyl]-1,3-benzodioxole.
| Compound Name | 5-[(3-fluoro-4-methylphenyl)methyl]-1,3-benzodioxole |
|---|---|
| PubChem CID | 153168719 |
| Molecular Formula | C15H13FO2 |
| Molecular Weight | 244.26 g/mol |
| Exact Mass | 244.09 |
| IUPAC Name | 5-[(3-fluoro-4-methylphenyl)methyl]-1,3-benzodioxole |
| SMILES | Cc1ccc(Cc2ccc3c(c2)OCO3)cc1F |
| InChI | InChI=1S/C15H13FO2/c1-10-2-3-11(7-13(10)16)6-12-4-5-14-15(8-12)18-9-17-14/h2-5,7-8H,6,9H2,1H3 |
| InChIKey | WDTVSXSKJLYMOO-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.26 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |