C20H24FIN4O3 — CID 111843741
N-[2-[[N-(1,3-benzodioxol-5-ylmethyl)-N'-methylcarbamimidoyl]amino]ethyl]-3-fluoro-4-methylbenzamide;hydroiodide (PubChem CID 111843741) has the molecular formula C20H24FIN4O3 and a molecular weight of 514.34 g/mol. Its IUPAC name is N-[2-[[N-(1,3-benzodioxol-5-ylmethyl)-N'-methylcarbamimidoyl]amino]ethyl]-3-fluoro-4-methylbenzamide;hydroiodide.
| Compound Name | N-[2-[[N-(1,3-benzodioxol-5-ylmethyl)-N'-methylcarbamimidoyl]amino]ethyl]-3-fluoro-4-methylbenzamide;hydroiodide |
|---|---|
| PubChem CID | 111843741 |
| Molecular Formula | C20H24FIN4O3 |
| Molecular Weight | 514.34 g/mol |
| Exact Mass | 514.09 |
| IUPAC Name | N-[2-[[N-(1,3-benzodioxol-5-ylmethyl)-N'-methylcarbamimidoyl]amino]ethyl]-3-fluoro-4-methylbenzamide;hydroiodide |
| SMILES | C/N=C(\NCCNC(=O)c1ccc(C)c(F)c1)NCc1ccc2c(c1)OCO2.I |
| InChI | InChI=1S/C20H23FN4O3.HI/c1-13-3-5-15(10-16(13)21)19(26)23-7-8-24-20(22-2)25-11-14-4-6-17-18(9-14)28-12-27-17;/h3-6,9-10H,7-8,11-12H2,1-2H3,(H,23,26)(H2,22,24,25);1H |
| InChIKey | CVQBBUUREIODKL-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 83.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.34 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|