C9H11N2O2+ — CID 6346816
[1-amino-2-(1,3-benzodioxol-5-yl)ethylidene]azanium (PubChem CID 6346816) has the molecular formula C9H11N2O2+ and a molecular weight of 179.20 g/mol. Its IUPAC name is [1-amino-2-(1,3-benzodioxol-5-yl)ethylidene]azanium.
| Compound Name | [1-amino-2-(1,3-benzodioxol-5-yl)ethylidene]azanium |
|---|---|
| PubChem CID | 6346816 |
| Molecular Formula | C9H11N2O2+ |
| Molecular Weight | 179.20 g/mol |
| Exact Mass | 179.08 |
| IUPAC Name | [1-amino-2-(1,3-benzodioxol-5-yl)ethylidene]azanium |
| SMILES | NC(=[NH2+])Cc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C9H10N2O2/c10-9(11)4-6-1-2-7-8(3-6)13-5-12-7/h1-3H,4-5H2,(H3,10,11)/p+1 |
| InChIKey | JAAMYYCAHSQEPC-UHFFFAOYSA-O |
| XLogP | -0.93 |
| TPSA | 70.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.20 |
| LogP ≤ 5 | -0.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|