C16H16Cl2N2O2 — CID 69189906
2-(1,3-benzodioxol-5-yl)-N'-[(2-chlorophenyl)methyl]ethanimidamide;hydrochloride (PubChem CID 69189906) has the molecular formula C16H16Cl2N2O2 and a molecular weight of 339.22 g/mol. Its IUPAC name is 2-(1,3-benzodioxol-5-yl)-N'-[(2-chlorophenyl)methyl]ethanimidamide;hydrochloride.
| Compound Name | 2-(1,3-benzodioxol-5-yl)-N'-[(2-chlorophenyl)methyl]ethanimidamide;hydrochloride |
|---|---|
| PubChem CID | 69189906 |
| Molecular Formula | C16H16Cl2N2O2 |
| Molecular Weight | 339.22 g/mol |
| Exact Mass | 338.06 |
| IUPAC Name | 2-(1,3-benzodioxol-5-yl)-N'-[(2-chlorophenyl)methyl]ethanimidamide;hydrochloride |
| SMILES | Cl.N/C(Cc1ccc2c(c1)OCO2)=N\Cc1ccccc1Cl |
| InChI | InChI=1S/C16H15ClN2O2.ClH/c17-13-4-2-1-3-12(13)9-19-16(18)8-11-5-6-14-15(7-11)21-10-20-14;/h1-7H,8-10H2,(H2,18,19);1H |
| InChIKey | MQZCRFKTFKLVAO-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 56.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.22 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|