C18H22N6O8S-2 — CID 23619438
bis(2-(1,3-benzodioxol-5-ylmethyl)guanidine);sulfate (PubChem CID 23619438) has the molecular formula C18H22N6O8S-2 and a molecular weight of 482.48 g/mol. Its IUPAC name is bis(2-(1,3-benzodioxol-5-ylmethyl)guanidine);sulfate.
| Compound Name | bis(2-(1,3-benzodioxol-5-ylmethyl)guanidine);sulfate |
|---|---|
| PubChem CID | 23619438 |
| Molecular Formula | C18H22N6O8S-2 |
| Molecular Weight | 482.48 g/mol |
| Exact Mass | 482.12 |
| IUPAC Name | bis(2-(1,3-benzodioxol-5-ylmethyl)guanidine);sulfate |
| SMILES | NC(N)=NCc1ccc2c(c1)OCO2.NC(N)=NCc1ccc2c(c1)OCO2.O=S(=O)([O-])[O-] |
| InChI | InChI=1S/2C9H11N3O2.H2O4S/c2*10-9(11)12-4-6-1-2-7-8(3-6)14-5-13-7;1-5(2,3)4/h2*1-3H,4-5H2,(H4,10,11,12);(H2,1,2,3,4)/p-2 |
| InChIKey | QMXJIKQXUYRZIE-UHFFFAOYSA-L |
| XLogP | -0.96 |
| TPSA | 245.98 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.48 |
| LogP ≤ 5 | -0.96 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|