C11H14F3N3O4S — CID 166434794
2-(2,3-dihydro-1-benzofuran-5-ylmethyl)guanidine;trifluoromethanesulfonic acid (PubChem CID 166434794) has the molecular formula C11H14F3N3O4S and a molecular weight of 341.31 g/mol. Its IUPAC name is 2-(2,3-dihydro-1-benzofuran-5-ylmethyl)guanidine;trifluoromethanesulfonic acid.
| Compound Name | 2-(2,3-dihydro-1-benzofuran-5-ylmethyl)guanidine;trifluoromethanesulfonic acid |
|---|---|
| PubChem CID | 166434794 |
| Molecular Formula | C11H14F3N3O4S |
| Molecular Weight | 341.31 g/mol |
| Exact Mass | 341.07 |
| IUPAC Name | 2-(2,3-dihydro-1-benzofuran-5-ylmethyl)guanidine;trifluoromethanesulfonic acid |
| SMILES | NC(N)=NCc1ccc2c(c1)CCO2.O=S(=O)(O)C(F)(F)F |
| InChI | InChI=1S/C10H13N3O.CHF3O3S/c11-10(12)13-6-7-1-2-9-8(5-7)3-4-14-9;2-1(3,4)8(5,6)7/h1-2,5H,3-4,6H2,(H4,11,12,13);(H,5,6,7) |
| InChIKey | OSRUSSNBHQMULO-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 128.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.31 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|