C11H14O6S — CID 159656752
2-(2,3-dihydro-1-benzofuran-5-yl)acetic acid;methanesulfonic acid (PubChem CID 159656752) has the molecular formula C11H14O6S and a molecular weight of 274.29 g/mol. Its IUPAC name is 2-(2,3-dihydro-1-benzofuran-5-yl)acetic acid;methanesulfonic acid.
| Compound Name | 2-(2,3-dihydro-1-benzofuran-5-yl)acetic acid;methanesulfonic acid |
|---|---|
| PubChem CID | 159656752 |
| Molecular Formula | C11H14O6S |
| Molecular Weight | 274.29 g/mol |
| Exact Mass | 274.05 |
| IUPAC Name | 2-(2,3-dihydro-1-benzofuran-5-yl)acetic acid;methanesulfonic acid |
| SMILES | CS(=O)(=O)O.O=C(O)Cc1ccc2c(c1)CCO2 |
| InChI | InChI=1S/C10H10O3.CH4O3S/c11-10(12)6-7-1-2-9-8(5-7)3-4-13-9;1-5(2,3)4/h1-2,5H,3-4,6H2,(H,11,12);1H3,(H,2,3,4) |
| InChIKey | MSGVBCYZWHLTAP-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 100.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.29 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|