C9H12N4O4 — CID 4213946
2-(1,3-benzodioxol-5-ylmethyl)-1-(dihydroxyamino)guanidine (PubChem CID 4213946) has the molecular formula C9H12N4O4 and a molecular weight of 240.22 g/mol. Its IUPAC name is 2-(1,3-benzodioxol-5-ylmethyl)-1-(dihydroxyamino)guanidine.
| Compound Name | 2-(1,3-benzodioxol-5-ylmethyl)-1-(dihydroxyamino)guanidine |
|---|---|
| PubChem CID | 4213946 |
| Molecular Formula | C9H12N4O4 |
| Molecular Weight | 240.22 g/mol |
| Exact Mass | 240.09 |
| IUPAC Name | 2-(1,3-benzodioxol-5-ylmethyl)-1-(dihydroxyamino)guanidine |
| SMILES | N/C(=N\Cc1ccc2c(c1)OCO2)NN(O)O |
| InChI | InChI=1S/C9H12N4O4/c10-9(12-13(14)15)11-4-6-1-2-7-8(3-6)17-5-16-7/h1-3,14-15H,4-5H2,(H3,10,11,12) |
| InChIKey | NQWAXKZJXGHLAC-UHFFFAOYSA-N |
| XLogP | -0.19 |
| TPSA | 112.57 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.22 |
| LogP ≤ 5 | -0.19 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|