C16H11Cl2N3O2 — CID 142632937
4-(1,3-benzodioxol-5-ylmethyl)-1,6-dichlorophthalazin-5-amine (PubChem CID 142632937) has the molecular formula C16H11Cl2N3O2 and a molecular weight of 348.19 g/mol. Its IUPAC name is 4-(1,3-benzodioxol-5-ylmethyl)-1,6-dichlorophthalazin-5-amine.
| Compound Name | 4-(1,3-benzodioxol-5-ylmethyl)-1,6-dichlorophthalazin-5-amine |
|---|---|
| PubChem CID | 142632937 |
| Molecular Formula | C16H11Cl2N3O2 |
| Molecular Weight | 348.19 g/mol |
| Exact Mass | 347.02 |
| IUPAC Name | 4-(1,3-benzodioxol-5-ylmethyl)-1,6-dichlorophthalazin-5-amine |
| SMILES | Nc1c(Cl)ccc2c(Cl)nnc(Cc3ccc4c(c3)OCO4)c12 |
| InChI | InChI=1S/C16H11Cl2N3O2/c17-10-3-2-9-14(15(10)19)11(20-21-16(9)18)5-8-1-4-12-13(6-8)23-7-22-12/h1-4,6H,5,7,19H2 |
| InChIKey | HEHJBDCBOAYMAG-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 70.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.19 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|