C17H14ClN3O2 — CID 20646869
N-(1,3-benzodioxol-5-ylmethyl)-4-chloro-7-methylphthalazin-1-amine (PubChem CID 20646869) has the molecular formula C17H14ClN3O2 and a molecular weight of 327.77 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-ylmethyl)-4-chloro-7-methylphthalazin-1-amine.
| Compound Name | N-(1,3-benzodioxol-5-ylmethyl)-4-chloro-7-methylphthalazin-1-amine |
|---|---|
| PubChem CID | 20646869 |
| Molecular Formula | C17H14ClN3O2 |
| Molecular Weight | 327.77 g/mol |
| Exact Mass | 327.08 |
| IUPAC Name | N-(1,3-benzodioxol-5-ylmethyl)-4-chloro-7-methylphthalazin-1-amine |
| SMILES | Cc1ccc2c(Cl)nnc(NCc3ccc4c(c3)OCO4)c2c1 |
| InChI | InChI=1S/C17H14ClN3O2/c1-10-2-4-12-13(6-10)17(21-20-16(12)18)19-8-11-3-5-14-15(7-11)23-9-22-14/h2-7H,8-9H2,1H3,(H,19,21) |
| InChIKey | ILNPGLQDPSGMTM-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 56.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.77 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |