C12H10ClN3O3 — CID 63021904
4-(1,3-benzodioxol-5-ylmethoxy)-6-chloropyrimidin-5-amine (PubChem CID 63021904) has the molecular formula C12H10ClN3O3 and a molecular weight of 279.68 g/mol. Its IUPAC name is 4-(1,3-benzodioxol-5-ylmethoxy)-6-chloropyrimidin-5-amine.
| Compound Name | 4-(1,3-benzodioxol-5-ylmethoxy)-6-chloropyrimidin-5-amine |
|---|---|
| PubChem CID | 63021904 |
| Molecular Formula | C12H10ClN3O3 |
| Molecular Weight | 279.68 g/mol |
| Exact Mass | 279.04 |
| IUPAC Name | 4-(1,3-benzodioxol-5-ylmethoxy)-6-chloropyrimidin-5-amine |
| SMILES | Nc1c(Cl)ncnc1OCc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C12H10ClN3O3/c13-11-10(14)12(16-5-15-11)17-4-7-1-2-8-9(3-7)19-6-18-8/h1-3,5H,4,6,14H2 |
| InChIKey | MDKYLXCIKICLDK-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 79.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.68 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |