C13H11Cl2N3O3 — CID 102762731
[6-(1,3-benzodioxol-5-ylmethoxy)-3,5-dichloro-2-pyridinyl]hydrazine (PubChem CID 102762731) has the molecular formula C13H11Cl2N3O3 and a molecular weight of 328.16 g/mol. Its IUPAC name is [6-(1,3-benzodioxol-5-ylmethoxy)-3,5-dichloro-2-pyridinyl]hydrazine.
| Compound Name | [6-(1,3-benzodioxol-5-ylmethoxy)-3,5-dichloro-2-pyridinyl]hydrazine |
|---|---|
| PubChem CID | 102762731 |
| Molecular Formula | C13H11Cl2N3O3 |
| Molecular Weight | 328.16 g/mol |
| Exact Mass | 327.02 |
| IUPAC Name | [6-(1,3-benzodioxol-5-ylmethoxy)-3,5-dichloro-2-pyridinyl]hydrazine |
| SMILES | NNc1nc(OCc2ccc3c(c2)OCO3)c(Cl)cc1Cl |
| InChI | InChI=1S/C13H11Cl2N3O3/c14-8-4-9(15)13(17-12(8)18-16)19-5-7-1-2-10-11(3-7)21-6-20-10/h1-4H,5-6,16H2,(H,17,18) |
| InChIKey | ILGUPVAPEBGZOM-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 78.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.16 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|