C15H15N3O4 — CID 142987779
2-[2-(1,3-benzodioxol-5-ylmethoxy)-3-pyridinyl]acetohydrazide (PubChem CID 142987779) has the molecular formula C15H15N3O4 and a molecular weight of 301.30 g/mol. Its IUPAC name is 2-[2-(1,3-benzodioxol-5-ylmethoxy)-3-pyridinyl]acetohydrazide.
| Compound Name | 2-[2-(1,3-benzodioxol-5-ylmethoxy)-3-pyridinyl]acetohydrazide |
|---|---|
| PubChem CID | 142987779 |
| Molecular Formula | C15H15N3O4 |
| Molecular Weight | 301.30 g/mol |
| Exact Mass | 301.11 |
| IUPAC Name | 2-[2-(1,3-benzodioxol-5-ylmethoxy)-3-pyridinyl]acetohydrazide |
| SMILES | NNC(=O)Cc1cccnc1OCc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C15H15N3O4/c16-18-14(19)7-11-2-1-5-17-15(11)20-8-10-3-4-12-13(6-10)22-9-21-12/h1-6H,7-9,16H2,(H,18,19) |
| InChIKey | HGGZOWXCIVDYMZ-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 95.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.30 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|