C14H12N4O3 — CID 80843714
8-(1,3-benzodioxol-5-ylmethoxy)imidazo[1,2-a]pyrazin-6-amine (PubChem CID 80843714) has the molecular formula C14H12N4O3 and a molecular weight of 284.28 g/mol. Its IUPAC name is 8-(1,3-benzodioxol-5-ylmethoxy)imidazo[1,2-a]pyrazin-6-amine.
| Compound Name | 8-(1,3-benzodioxol-5-ylmethoxy)imidazo[1,2-a]pyrazin-6-amine |
|---|---|
| PubChem CID | 80843714 |
| Molecular Formula | C14H12N4O3 |
| Molecular Weight | 284.28 g/mol |
| Exact Mass | 284.09 |
| IUPAC Name | 8-(1,3-benzodioxol-5-ylmethoxy)imidazo[1,2-a]pyrazin-6-amine |
| SMILES | Nc1cn2ccnc2c(OCc2ccc3c(c2)OCO3)n1 |
| InChI | InChI=1S/C14H12N4O3/c15-12-6-18-4-3-16-13(18)14(17-12)19-7-9-1-2-10-11(5-9)21-8-20-10/h1-6H,7-8,15H2 |
| InChIKey | NUJGISHMQXXABV-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 83.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.28 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |