C13H20N4O — CID 80861684
8-heptoxyimidazo[1,2-a]pyrazin-6-amine (PubChem CID 80861684) has the molecular formula C13H20N4O and a molecular weight of 248.33 g/mol. Its IUPAC name is 8-heptoxyimidazo[1,2-a]pyrazin-6-amine.
| Compound Name | 8-heptoxyimidazo[1,2-a]pyrazin-6-amine |
|---|---|
| PubChem CID | 80861684 |
| Molecular Formula | C13H20N4O |
| Molecular Weight | 248.33 g/mol |
| Exact Mass | 248.16 |
| IUPAC Name | 8-heptoxyimidazo[1,2-a]pyrazin-6-amine |
| SMILES | CCCCCCCOc1nc(N)cn2ccnc12 |
| InChI | InChI=1S/C13H20N4O/c1-2-3-4-5-6-9-18-13-12-15-7-8-17(12)10-11(14)16-13/h7-8,10H,2-6,9,14H2,1H3 |
| InChIKey | BDYSUFZTIVLLED-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 65.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.33 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|