C11H16N4O — CID 125496106
8-hexoxy-[1,2,4]triazolo[4,3-a]pyrazine (PubChem CID 125496106) has the molecular formula C11H16N4O and a molecular weight of 220.28 g/mol. Its IUPAC name is 8-hexoxy-[1,2,4]triazolo[4,3-a]pyrazine.
| Compound Name | 8-hexoxy-[1,2,4]triazolo[4,3-a]pyrazine |
|---|---|
| PubChem CID | 125496106 |
| Molecular Formula | C11H16N4O |
| Molecular Weight | 220.28 g/mol |
| Exact Mass | 220.13 |
| IUPAC Name | 8-hexoxy-[1,2,4]triazolo[4,3-a]pyrazine |
| SMILES | CCCCCCOc1nccn2cnnc12 |
| InChI | InChI=1S/C11H16N4O/c1-2-3-4-5-8-16-11-10-14-13-9-15(10)7-6-12-11/h6-7,9H,2-5,8H2,1H3 |
| InChIKey | HFRBMZDRMXEJFT-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 52.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.28 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|