C8H10ClN5 — CID 65030166
N-(3-chloropropyl)-[1,2,4]triazolo[4,3-a]pyrazin-8-amine (PubChem CID 65030166) has the molecular formula C8H10ClN5 and a molecular weight of 211.66 g/mol. Its IUPAC name is N-(3-chloropropyl)-[1,2,4]triazolo[4,3-a]pyrazin-8-amine.
| Compound Name | N-(3-chloropropyl)-[1,2,4]triazolo[4,3-a]pyrazin-8-amine |
|---|---|
| PubChem CID | 65030166 |
| Molecular Formula | C8H10ClN5 |
| Molecular Weight | 211.66 g/mol |
| Exact Mass | 211.06 |
| IUPAC Name | N-(3-chloropropyl)-[1,2,4]triazolo[4,3-a]pyrazin-8-amine |
| SMILES | ClCCCNc1nccn2cnnc12 |
| InChI | InChI=1S/C8H10ClN5/c9-2-1-3-10-7-8-13-12-6-14(8)5-4-11-7/h4-6H,1-3H2,(H,10,11) |
| InChIKey | SFLNXZWEDKWNMB-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 55.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.66 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|