C9H12ClN5 — CID 83186917
N-(4-chlorobutan-2-yl)-[1,2,4]triazolo[4,3-a]pyrazin-8-amine (PubChem CID 83186917) has the molecular formula C9H12ClN5 and a molecular weight of 225.68 g/mol. Its IUPAC name is N-(4-chlorobutan-2-yl)-[1,2,4]triazolo[4,3-a]pyrazin-8-amine.
| Compound Name | N-(4-chlorobutan-2-yl)-[1,2,4]triazolo[4,3-a]pyrazin-8-amine |
|---|---|
| PubChem CID | 83186917 |
| Molecular Formula | C9H12ClN5 |
| Molecular Weight | 225.68 g/mol |
| Exact Mass | 225.08 |
| IUPAC Name | N-(4-chlorobutan-2-yl)-[1,2,4]triazolo[4,3-a]pyrazin-8-amine |
| SMILES | CC(CCCl)Nc1nccn2cnnc12 |
| InChI | InChI=1S/C9H12ClN5/c1-7(2-3-10)13-8-9-14-12-6-15(9)5-4-11-8/h4-7H,2-3H2,1H3,(H,11,13) |
| InChIKey | OFTUWXNGDYUCTQ-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 55.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.68 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|