C12H19N5O — CID 113245597
3-[([1,2,4]triazolo[4,3-a]pyrazin-8-ylamino)methyl]hexan-1-ol (PubChem CID 113245597) has the molecular formula C12H19N5O and a molecular weight of 249.32 g/mol. Its IUPAC name is 3-[([1,2,4]triazolo[4,3-a]pyrazin-8-ylamino)methyl]hexan-1-ol.
| Compound Name | 3-[([1,2,4]triazolo[4,3-a]pyrazin-8-ylamino)methyl]hexan-1-ol |
|---|---|
| PubChem CID | 113245597 |
| Molecular Formula | C12H19N5O |
| Molecular Weight | 249.32 g/mol |
| Exact Mass | 249.16 |
| IUPAC Name | 3-[([1,2,4]triazolo[4,3-a]pyrazin-8-ylamino)methyl]hexan-1-ol |
| SMILES | CCCC(CCO)CNc1nccn2cnnc12 |
| InChI | InChI=1S/C12H19N5O/c1-2-3-10(4-7-18)8-14-11-12-16-15-9-17(12)6-5-13-11/h5-6,9-10,18H,2-4,7-8H2,1H3,(H,13,14) |
| InChIKey | LQHPSSANTGGHRF-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 75.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.32 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |