C13H21N5O — CID 106118645
3-[[(6-aminoimidazo[1,2-a]pyrazin-8-yl)amino]methyl]hexan-1-ol (PubChem CID 106118645) has the molecular formula C13H21N5O and a molecular weight of 263.34 g/mol. Its IUPAC name is 3-[[(6-aminoimidazo[1,2-a]pyrazin-8-yl)amino]methyl]hexan-1-ol.
| Compound Name | 3-[[(6-aminoimidazo[1,2-a]pyrazin-8-yl)amino]methyl]hexan-1-ol |
|---|---|
| PubChem CID | 106118645 |
| Molecular Formula | C13H21N5O |
| Molecular Weight | 263.34 g/mol |
| Exact Mass | 263.17 |
| IUPAC Name | 3-[[(6-aminoimidazo[1,2-a]pyrazin-8-yl)amino]methyl]hexan-1-ol |
| SMILES | CCCC(CCO)CNc1nc(N)cn2ccnc12 |
| InChI | InChI=1S/C13H21N5O/c1-2-3-10(4-7-19)8-16-12-13-15-5-6-18(13)9-11(14)17-12/h5-6,9-10,19H,2-4,7-8,14H2,1H3,(H,16,17) |
| InChIKey | YKNOLOGHJADFTG-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 88.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.34 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |