C14H23N5 — CID 107818998
8-N-(2-ethylhexyl)imidazo[1,2-a]pyrazine-6,8-diamine (PubChem CID 107818998) has the molecular formula C14H23N5 and a molecular weight of 261.37 g/mol. Its IUPAC name is 8-N-(2-ethylhexyl)imidazo[1,2-a]pyrazine-6,8-diamine.
| Compound Name | 8-N-(2-ethylhexyl)imidazo[1,2-a]pyrazine-6,8-diamine |
|---|---|
| PubChem CID | 107818998 |
| Molecular Formula | C14H23N5 |
| Molecular Weight | 261.37 g/mol |
| Exact Mass | 261.20 |
| IUPAC Name | 8-N-(2-ethylhexyl)imidazo[1,2-a]pyrazine-6,8-diamine |
| SMILES | CCCCC(CC)CNc1nc(N)cn2ccnc12 |
| InChI | InChI=1S/C14H23N5/c1-3-5-6-11(4-2)9-17-13-14-16-7-8-19(14)10-12(15)18-13/h7-8,10-11H,3-6,9,15H2,1-2H3,(H,17,18) |
| InChIKey | VNSRQIZBMDQUPP-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 68.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.37 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |