C9H11N5O2 — CID 80776875
methyl 2-[(6-aminoimidazo[1,2-a]pyrazin-8-yl)amino]acetate (PubChem CID 80776875) has the molecular formula C9H11N5O2 and a molecular weight of 221.22 g/mol. Its IUPAC name is methyl 2-[(6-aminoimidazo[1,2-a]pyrazin-8-yl)amino]acetate.
| Compound Name | methyl 2-[(6-aminoimidazo[1,2-a]pyrazin-8-yl)amino]acetate |
|---|---|
| PubChem CID | 80776875 |
| Molecular Formula | C9H11N5O2 |
| Molecular Weight | 221.22 g/mol |
| Exact Mass | 221.09 |
| IUPAC Name | methyl 2-[(6-aminoimidazo[1,2-a]pyrazin-8-yl)amino]acetate |
| SMILES | COC(=O)CNc1nc(N)cn2ccnc12 |
| InChI | InChI=1S/C9H11N5O2/c1-16-7(15)4-12-8-9-11-2-3-14(9)5-6(10)13-8/h2-3,5H,4,10H2,1H3,(H,12,13) |
| InChIKey | BRONUSAQBUABFV-UHFFFAOYSA-N |
| XLogP | -0.10 |
| TPSA | 94.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.22 |
| LogP ≤ 5 | -0.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |