About 5-[(6-aminoimidazo[1,2-a]pyrazin-8-yl)amino]pentanamide
5-[(6-aminoimidazo[1,2-a]pyrazin-8-yl)amino]pentanamide (PubChem CID 106241738) has the molecular formula C11H16N6O
and a molecular weight of 248.29 g/mol. Its IUPAC name is 5-[(6-aminoimidazo[1,2-a]pyrazin-8-yl)amino]pentanamide.
Molecular Properties
| Compound Name | 5-[(6-aminoimidazo[1,2-a]pyrazin-8-yl)amino]pentanamide |
| PubChem CID | 106241738 |
| Molecular Formula | C11H16N6O |
| Molecular Weight | 248.29 g/mol |
| Exact Mass | 248.14 |
| IUPAC Name | 5-[(6-aminoimidazo[1,2-a]pyrazin-8-yl)amino]pentanamide |
| SMILES | NC(=O)CCCCNc1nc(N)cn2ccnc12 |
| InChI | InChI=1S/C11H16N6O/c12-8-7-17-6-5-15-11(17)10(16-8)14-4-2-1-3-9(13)18/h5-7H,1-4,12H2,(H2,13,18)(H,14,16) |
| InChIKey | ZNCVZCDKJVFDJW-UHFFFAOYSA-N |
| XLogP | 0.38 |
| TPSA | 111.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 248.29 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 5-[(6-aminoimidazo[1,2-a]pyrazin-8-yl)amino]pentanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[(6-aminoimidazo[1,2-a]pyrazin-8-yl)amino]pentanamide?
The IUPAC name of 5-[(6-aminoimidazo[1,2-a]pyrazin-8-yl)amino]pentanamide (CID 106241738) is 5-[(6-aminoimidazo[1,2-a]pyrazin-8-yl)amino]pentanamide.
What is the SMILES notation for 5-[(6-aminoimidazo[1,2-a]pyrazin-8-yl)amino]pentanamide?
The canonical SMILES for 5-[(6-aminoimidazo[1,2-a]pyrazin-8-yl)amino]pentanamide is NC(=O)CCCCNc1nc(N)cn2ccnc12.
What is the InChIKey of 5-[(6-aminoimidazo[1,2-a]pyrazin-8-yl)amino]pentanamide?
The InChIKey is ZNCVZCDKJVFDJW-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16N6O/c12-8-7-17-6-5-15-11(17)10(16-8)14-4-2-1-3-9(13)18/h5-7H,1-4,12H2,(H2,13,18)(H,14,16).
What are the key properties of 5-[(6-aminoimidazo[1,2-a]pyrazin-8-yl)amino]pentanamide?
5-[(6-aminoimidazo[1,2-a]pyrazin-8-yl)amino]pentanamide has a molecular weight of 248.29 g/mol, XLogP of 0.38, 6 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[(6-aminoimidazo[1,2-a]pyrazin-8-yl)amino]pentanamide is sourced from PubChem (CID 106241738), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).