About 3-[(6-bromoimidazo[1,2-a]pyrazin-8-yl)amino]propanamide
3-[(6-bromoimidazo[1,2-a]pyrazin-8-yl)amino]propanamide (PubChem CID 79958127) has the molecular formula C9H10BrN5O
and a molecular weight of 284.12 g/mol. Its IUPAC name is 3-[(6-bromoimidazo[1,2-a]pyrazin-8-yl)amino]propanamide.
Molecular Properties
| Compound Name | 3-[(6-bromoimidazo[1,2-a]pyrazin-8-yl)amino]propanamide |
| PubChem CID | 79958127 |
| Molecular Formula | C9H10BrN5O |
| Molecular Weight | 284.12 g/mol |
| Exact Mass | 283.01 |
| IUPAC Name | 3-[(6-bromoimidazo[1,2-a]pyrazin-8-yl)amino]propanamide |
| SMILES | NC(=O)CCNc1nc(Br)cn2ccnc12 |
| InChI | InChI=1S/C9H10BrN5O/c10-6-5-15-4-3-13-9(15)8(14-6)12-2-1-7(11)16/h3-5H,1-2H2,(H2,11,16)(H,12,14) |
| InChIKey | DZVKYIFTCGKIBE-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 85.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 284.12 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-[(6-bromoimidazo[1,2-a]pyrazin-8-yl)amino]propanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(6-bromoimidazo[1,2-a]pyrazin-8-yl)amino]propanamide?
The IUPAC name of 3-[(6-bromoimidazo[1,2-a]pyrazin-8-yl)amino]propanamide (CID 79958127) is 3-[(6-bromoimidazo[1,2-a]pyrazin-8-yl)amino]propanamide.
What is the SMILES notation for 3-[(6-bromoimidazo[1,2-a]pyrazin-8-yl)amino]propanamide?
The canonical SMILES for 3-[(6-bromoimidazo[1,2-a]pyrazin-8-yl)amino]propanamide is NC(=O)CCNc1nc(Br)cn2ccnc12.
What is the InChIKey of 3-[(6-bromoimidazo[1,2-a]pyrazin-8-yl)amino]propanamide?
The InChIKey is DZVKYIFTCGKIBE-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10BrN5O/c10-6-5-15-4-3-13-9(15)8(14-6)12-2-1-7(11)16/h3-5H,1-2H2,(H2,11,16)(H,12,14).
What are the key properties of 3-[(6-bromoimidazo[1,2-a]pyrazin-8-yl)amino]propanamide?
3-[(6-bromoimidazo[1,2-a]pyrazin-8-yl)amino]propanamide has a molecular weight of 284.12 g/mol, XLogP of 0.78, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(6-bromoimidazo[1,2-a]pyrazin-8-yl)amino]propanamide is sourced from PubChem (CID 79958127), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).