C11H15BrN4OS — CID 106311300
3-[2-[(6-bromoimidazo[1,2-a]pyrazin-8-yl)amino]ethylsulfanyl]propan-1-ol (PubChem CID 106311300) has the molecular formula C11H15BrN4OS and a molecular weight of 331.24 g/mol. Its IUPAC name is 3-[2-[(6-bromoimidazo[1,2-a]pyrazin-8-yl)amino]ethylsulfanyl]propan-1-ol.
| Compound Name | 3-[2-[(6-bromoimidazo[1,2-a]pyrazin-8-yl)amino]ethylsulfanyl]propan-1-ol |
|---|---|
| PubChem CID | 106311300 |
| Molecular Formula | C11H15BrN4OS |
| Molecular Weight | 331.24 g/mol |
| Exact Mass | 330.01 |
| IUPAC Name | 3-[2-[(6-bromoimidazo[1,2-a]pyrazin-8-yl)amino]ethylsulfanyl]propan-1-ol |
| SMILES | OCCCSCCNc1nc(Br)cn2ccnc12 |
| InChI | InChI=1S/C11H15BrN4OS/c12-9-8-16-4-2-14-11(16)10(15-9)13-3-7-18-6-1-5-17/h2,4,8,17H,1,3,5-7H2,(H,13,15) |
| InChIKey | FKIGICPPSJCGHG-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 62.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.24 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|