About 3-[2-(pyrazolo[1,5-a]pyrazin-4-ylamino)ethylsulfanyl]propan-1-ol
3-[2-(pyrazolo[1,5-a]pyrazin-4-ylamino)ethylsulfanyl]propan-1-ol (PubChem CID 106307415) has the molecular formula C11H16N4OS
and a molecular weight of 252.34 g/mol. Its IUPAC name is 3-[2-(pyrazolo[1,5-a]pyrazin-4-ylamino)ethylsulfanyl]propan-1-ol.
Molecular Properties
| Compound Name | 3-[2-(pyrazolo[1,5-a]pyrazin-4-ylamino)ethylsulfanyl]propan-1-ol |
| PubChem CID | 106307415 |
| Molecular Formula | C11H16N4OS |
| Molecular Weight | 252.34 g/mol |
| Exact Mass | 252.10 |
| IUPAC Name | 3-[2-(pyrazolo[1,5-a]pyrazin-4-ylamino)ethylsulfanyl]propan-1-ol |
| SMILES | OCCCSCCNc1nccn2nccc12 |
| InChI | InChI=1S/C11H16N4OS/c16-7-1-8-17-9-5-13-11-10-2-3-14-15(10)6-4-12-11/h2-4,6,16H,1,5,7-9H2,(H,12,13) |
| InChIKey | BGAXBIRGDZYUKO-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 62.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 252.34 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-[2-(pyrazolo[1,5-a]pyrazin-4-ylamino)ethylsulfanyl]propan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[2-(pyrazolo[1,5-a]pyrazin-4-ylamino)ethylsulfanyl]propan-1-ol?
The IUPAC name of 3-[2-(pyrazolo[1,5-a]pyrazin-4-ylamino)ethylsulfanyl]propan-1-ol (CID 106307415) is 3-[2-(pyrazolo[1,5-a]pyrazin-4-ylamino)ethylsulfanyl]propan-1-ol.
What is the SMILES notation for 3-[2-(pyrazolo[1,5-a]pyrazin-4-ylamino)ethylsulfanyl]propan-1-ol?
The canonical SMILES for 3-[2-(pyrazolo[1,5-a]pyrazin-4-ylamino)ethylsulfanyl]propan-1-ol is OCCCSCCNc1nccn2nccc12.
What is the InChIKey of 3-[2-(pyrazolo[1,5-a]pyrazin-4-ylamino)ethylsulfanyl]propan-1-ol?
The InChIKey is BGAXBIRGDZYUKO-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16N4OS/c16-7-1-8-17-9-5-13-11-10-2-3-14-15(10)6-4-12-11/h2-4,6,16H,1,5,7-9H2,(H,12,13).
What are the key properties of 3-[2-(pyrazolo[1,5-a]pyrazin-4-ylamino)ethylsulfanyl]propan-1-ol?
3-[2-(pyrazolo[1,5-a]pyrazin-4-ylamino)ethylsulfanyl]propan-1-ol has a molecular weight of 252.34 g/mol, XLogP of 1.26, 7 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[2-(pyrazolo[1,5-a]pyrazin-4-ylamino)ethylsulfanyl]propan-1-ol is sourced from PubChem (CID 106307415), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).