C11H16N4OS — CID 106307415
3-[2-(pyrazolo[1,5-a]pyrazin-4-ylamino)ethylsulfanyl]propan-1-ol (PubChem CID 106307415) has the molecular formula C11H16N4OS and a molecular weight of 252.34 g/mol. Its IUPAC name is 3-[2-(pyrazolo[1,5-a]pyrazin-4-ylamino)ethylsulfanyl]propan-1-ol.
| Compound Name | 3-[2-(pyrazolo[1,5-a]pyrazin-4-ylamino)ethylsulfanyl]propan-1-ol |
|---|---|
| PubChem CID | 106307415 |
| Molecular Formula | C11H16N4OS |
| Molecular Weight | 252.34 g/mol |
| Exact Mass | 252.10 |
| IUPAC Name | 3-[2-(pyrazolo[1,5-a]pyrazin-4-ylamino)ethylsulfanyl]propan-1-ol |
| SMILES | OCCCSCCNc1nccn2nccc12 |
| InChI | InChI=1S/C11H16N4OS/c16-7-1-8-17-9-5-13-11-10-2-3-14-15(10)6-4-12-11/h2-4,6,16H,1,5,7-9H2,(H,12,13) |
| InChIKey | BGAXBIRGDZYUKO-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 62.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.34 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|