C14H14N4 — CID 104730493
N-(2-phenylethyl)pyrazolo[1,5-a]pyrazin-4-amine (PubChem CID 104730493) has the molecular formula C14H14N4 and a molecular weight of 238.29 g/mol. Its IUPAC name is N-(2-phenylethyl)pyrazolo[1,5-a]pyrazin-4-amine.
| Compound Name | N-(2-phenylethyl)pyrazolo[1,5-a]pyrazin-4-amine |
|---|---|
| PubChem CID | 104730493 |
| Molecular Formula | C14H14N4 |
| Molecular Weight | 238.29 g/mol |
| Exact Mass | 238.12 |
| IUPAC Name | N-(2-phenylethyl)pyrazolo[1,5-a]pyrazin-4-amine |
| SMILES | c1ccc(CCNc2nccn3nccc23)cc1 |
| InChI | InChI=1S/C14H14N4/c1-2-4-12(5-3-1)6-8-15-14-13-7-9-17-18(13)11-10-16-14/h1-5,7,9-11H,6,8H2,(H,15,16) |
| InChIKey | TZZWZRLEVIPTLE-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 42.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.29 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |