C13H11ClN4 — CID 104730459
N-[(2-chlorophenyl)methyl]pyrazolo[1,5-a]pyrazin-4-amine (PubChem CID 104730459) has the molecular formula C13H11ClN4 and a molecular weight of 258.71 g/mol. Its IUPAC name is N-[(2-chlorophenyl)methyl]pyrazolo[1,5-a]pyrazin-4-amine.
| Compound Name | N-[(2-chlorophenyl)methyl]pyrazolo[1,5-a]pyrazin-4-amine |
|---|---|
| PubChem CID | 104730459 |
| Molecular Formula | C13H11ClN4 |
| Molecular Weight | 258.71 g/mol |
| Exact Mass | 258.07 |
| IUPAC Name | N-[(2-chlorophenyl)methyl]pyrazolo[1,5-a]pyrazin-4-amine |
| SMILES | Clc1ccccc1CNc1nccn2nccc12 |
| InChI | InChI=1S/C13H11ClN4/c14-11-4-2-1-3-10(11)9-16-13-12-5-6-17-18(12)8-7-15-13/h1-8H,9H2,(H,15,16) |
| InChIKey | DKELFVPBFBHSDM-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 42.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.71 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |