C12H11N5 — CID 104730521
N-(pyridin-2-ylmethyl)pyrazolo[1,5-a]pyrazin-4-amine (PubChem CID 104730521) has the molecular formula C12H11N5 and a molecular weight of 225.26 g/mol. Its IUPAC name is N-(pyridin-2-ylmethyl)pyrazolo[1,5-a]pyrazin-4-amine.
| Compound Name | N-(pyridin-2-ylmethyl)pyrazolo[1,5-a]pyrazin-4-amine |
|---|---|
| PubChem CID | 104730521 |
| Molecular Formula | C12H11N5 |
| Molecular Weight | 225.26 g/mol |
| Exact Mass | 225.10 |
| IUPAC Name | N-(pyridin-2-ylmethyl)pyrazolo[1,5-a]pyrazin-4-amine |
| SMILES | c1ccc(CNc2nccn3nccc23)nc1 |
| InChI | InChI=1S/C12H11N5/c1-2-5-13-10(3-1)9-15-12-11-4-6-16-17(11)8-7-14-12/h1-8H,9H2,(H,14,15) |
| InChIKey | NPIXHPHGYWHEQU-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 55.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.26 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |