C12H16N4O2 — CID 104729297
6-(pyrazolo[1,5-a]pyrazin-4-ylamino)hexanoic acid (PubChem CID 104729297) has the molecular formula C12H16N4O2 and a molecular weight of 248.29 g/mol. Its IUPAC name is 6-(pyrazolo[1,5-a]pyrazin-4-ylamino)hexanoic acid.
| Compound Name | 6-(pyrazolo[1,5-a]pyrazin-4-ylamino)hexanoic acid |
|---|---|
| PubChem CID | 104729297 |
| Molecular Formula | C12H16N4O2 |
| Molecular Weight | 248.29 g/mol |
| Exact Mass | 248.13 |
| IUPAC Name | 6-(pyrazolo[1,5-a]pyrazin-4-ylamino)hexanoic acid |
| SMILES | O=C(O)CCCCCNc1nccn2nccc12 |
| InChI | InChI=1S/C12H16N4O2/c17-11(18)4-2-1-3-6-13-12-10-5-7-15-16(10)9-8-14-12/h5,7-9H,1-4,6H2,(H,13,14)(H,17,18) |
| InChIKey | HFUXBLRFMBHGHW-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 79.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.29 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|