C10H12N4O2 — CID 104729413
2-methyl-2-(pyrazolo[1,5-a]pyrazin-4-ylamino)propanoic acid (PubChem CID 104729413) has the molecular formula C10H12N4O2 and a molecular weight of 220.23 g/mol. Its IUPAC name is 2-methyl-2-(pyrazolo[1,5-a]pyrazin-4-ylamino)propanoic acid.
| Compound Name | 2-methyl-2-(pyrazolo[1,5-a]pyrazin-4-ylamino)propanoic acid |
|---|---|
| PubChem CID | 104729413 |
| Molecular Formula | C10H12N4O2 |
| Molecular Weight | 220.23 g/mol |
| Exact Mass | 220.10 |
| IUPAC Name | 2-methyl-2-(pyrazolo[1,5-a]pyrazin-4-ylamino)propanoic acid |
| SMILES | CC(C)(Nc1nccn2nccc12)C(=O)O |
| InChI | InChI=1S/C10H12N4O2/c1-10(2,9(15)16)13-8-7-3-4-12-14(7)6-5-11-8/h3-6H,1-2H3,(H,11,13)(H,15,16) |
| InChIKey | CGIFDPLRCFQPGA-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 79.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.23 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |