C14H20N4O2 — CID 104729611
4,4-dimethyl-6-(pyrazolo[1,5-a]pyrazin-4-ylamino)hexanoic acid (PubChem CID 104729611) has the molecular formula C14H20N4O2 and a molecular weight of 276.34 g/mol. Its IUPAC name is 4,4-dimethyl-6-(pyrazolo[1,5-a]pyrazin-4-ylamino)hexanoic acid.
| Compound Name | 4,4-dimethyl-6-(pyrazolo[1,5-a]pyrazin-4-ylamino)hexanoic acid |
|---|---|
| PubChem CID | 104729611 |
| Molecular Formula | C14H20N4O2 |
| Molecular Weight | 276.34 g/mol |
| Exact Mass | 276.16 |
| IUPAC Name | 4,4-dimethyl-6-(pyrazolo[1,5-a]pyrazin-4-ylamino)hexanoic acid |
| SMILES | CC(C)(CCNc1nccn2nccc12)CCC(=O)O |
| InChI | InChI=1S/C14H20N4O2/c1-14(2,5-3-12(19)20)6-8-15-13-11-4-7-17-18(11)10-9-16-13/h4,7,9-10H,3,5-6,8H2,1-2H3,(H,15,16)(H,19,20) |
| InChIKey | OAEFSKNECXWRCU-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 79.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.34 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |