About N,N-diethyl-2-(pyrazolo[1,5-a]pyrazin-4-ylamino)acetamide
N,N-diethyl-2-(pyrazolo[1,5-a]pyrazin-4-ylamino)acetamide (PubChem CID 104732080) has the molecular formula C12H17N5O
and a molecular weight of 247.30 g/mol. Its IUPAC name is N,N-diethyl-2-(pyrazolo[1,5-a]pyrazin-4-ylamino)acetamide.
Molecular Properties
| Compound Name | N,N-diethyl-2-(pyrazolo[1,5-a]pyrazin-4-ylamino)acetamide |
| PubChem CID | 104732080 |
| Molecular Formula | C12H17N5O |
| Molecular Weight | 247.30 g/mol |
| Exact Mass | 247.14 |
| IUPAC Name | N,N-diethyl-2-(pyrazolo[1,5-a]pyrazin-4-ylamino)acetamide |
| SMILES | CCN(CC)C(=O)CNc1nccn2nccc12 |
| InChI | InChI=1S/C12H17N5O/c1-3-16(4-2)11(18)9-14-12-10-5-6-15-17(10)8-7-13-12/h5-8H,3-4,9H2,1-2H3,(H,13,14) |
| InChIKey | NCXCPIRXKYSBOB-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 62.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 247.30 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N,N-diethyl-2-(pyrazolo[1,5-a]pyrazin-4-ylamino)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-diethyl-2-(pyrazolo[1,5-a]pyrazin-4-ylamino)acetamide?
The IUPAC name of N,N-diethyl-2-(pyrazolo[1,5-a]pyrazin-4-ylamino)acetamide (CID 104732080) is N,N-diethyl-2-(pyrazolo[1,5-a]pyrazin-4-ylamino)acetamide.
What is the SMILES notation for N,N-diethyl-2-(pyrazolo[1,5-a]pyrazin-4-ylamino)acetamide?
The canonical SMILES for N,N-diethyl-2-(pyrazolo[1,5-a]pyrazin-4-ylamino)acetamide is CCN(CC)C(=O)CNc1nccn2nccc12.
What is the InChIKey of N,N-diethyl-2-(pyrazolo[1,5-a]pyrazin-4-ylamino)acetamide?
The InChIKey is NCXCPIRXKYSBOB-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H17N5O/c1-3-16(4-2)11(18)9-14-12-10-5-6-15-17(10)8-7-13-12/h5-8H,3-4,9H2,1-2H3,(H,13,14).
What are the key properties of N,N-diethyl-2-(pyrazolo[1,5-a]pyrazin-4-ylamino)acetamide?
N,N-diethyl-2-(pyrazolo[1,5-a]pyrazin-4-ylamino)acetamide has a molecular weight of 247.30 g/mol, XLogP of 1.01, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-diethyl-2-(pyrazolo[1,5-a]pyrazin-4-ylamino)acetamide is sourced from PubChem (CID 104732080), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).