C11H14N4S — CID 106429998
N-(2-prop-2-enylsulfanylethyl)pyrazolo[1,5-a]pyrazin-4-amine (PubChem CID 106429998) has the molecular formula C11H14N4S and a molecular weight of 234.33 g/mol. Its IUPAC name is N-(2-prop-2-enylsulfanylethyl)pyrazolo[1,5-a]pyrazin-4-amine.
| Compound Name | N-(2-prop-2-enylsulfanylethyl)pyrazolo[1,5-a]pyrazin-4-amine |
|---|---|
| PubChem CID | 106429998 |
| Molecular Formula | C11H14N4S |
| Molecular Weight | 234.33 g/mol |
| Exact Mass | 234.09 |
| IUPAC Name | N-(2-prop-2-enylsulfanylethyl)pyrazolo[1,5-a]pyrazin-4-amine |
| SMILES | C=CCSCCNc1nccn2nccc12 |
| InChI | InChI=1S/C11H14N4S/c1-2-8-16-9-6-13-11-10-3-4-14-15(10)7-5-12-11/h2-5,7H,1,6,8-9H2,(H,12,13) |
| InChIKey | WNHRDUKHYHUDDE-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 42.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.33 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|