C10H17N3O2S — CID 103696656
3-[2-(3-hydroxypropylsulfanyl)ethylamino]-1-methylpyrazin-2-one (PubChem CID 103696656) has the molecular formula C10H17N3O2S and a molecular weight of 243.33 g/mol. Its IUPAC name is 3-[2-(3-hydroxypropylsulfanyl)ethylamino]-1-methylpyrazin-2-one.
| Compound Name | 3-[2-(3-hydroxypropylsulfanyl)ethylamino]-1-methylpyrazin-2-one |
|---|---|
| PubChem CID | 103696656 |
| Molecular Formula | C10H17N3O2S |
| Molecular Weight | 243.33 g/mol |
| Exact Mass | 243.10 |
| IUPAC Name | 3-[2-(3-hydroxypropylsulfanyl)ethylamino]-1-methylpyrazin-2-one |
| SMILES | Cn1ccnc(NCCSCCCO)c1=O |
| InChI | InChI=1S/C10H17N3O2S/c1-13-5-3-11-9(10(13)15)12-4-8-16-7-2-6-14/h3,5,14H,2,4,6-8H2,1H3,(H,11,12) |
| InChIKey | BUHBSZSRHGCNBB-UHFFFAOYSA-N |
| XLogP | 0.31 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.33 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|