C9H15N3O2 — CID 79033342
3-(4-hydroxybutan-2-ylamino)-1-methylpyrazin-2-one (PubChem CID 79033342) has the molecular formula C9H15N3O2 and a molecular weight of 197.24 g/mol. Its IUPAC name is 3-(4-hydroxybutan-2-ylamino)-1-methylpyrazin-2-one.
| Compound Name | 3-(4-hydroxybutan-2-ylamino)-1-methylpyrazin-2-one |
|---|---|
| PubChem CID | 79033342 |
| Molecular Formula | C9H15N3O2 |
| Molecular Weight | 197.24 g/mol |
| Exact Mass | 197.12 |
| IUPAC Name | 3-(4-hydroxybutan-2-ylamino)-1-methylpyrazin-2-one |
| SMILES | CC(CCO)Nc1nccn(C)c1=O |
| InChI | InChI=1S/C9H15N3O2/c1-7(3-6-13)11-8-9(14)12(2)5-4-10-8/h4-5,7,13H,3,6H2,1-2H3,(H,10,11) |
| InChIKey | MHNYKXXHVNWMEW-UHFFFAOYSA-N |
| XLogP | -0.04 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.24 |
| LogP ≤ 5 | -0.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |