About 3-(pyrazolo[1,5-a]pyrazin-4-ylamino)butan-1-ol
3-(pyrazolo[1,5-a]pyrazin-4-ylamino)butan-1-ol (PubChem CID 104732049) has the molecular formula C10H14N4O
and a molecular weight of 206.25 g/mol. Its IUPAC name is 3-(pyrazolo[1,5-a]pyrazin-4-ylamino)butan-1-ol.
Molecular Properties
| Compound Name | 3-(pyrazolo[1,5-a]pyrazin-4-ylamino)butan-1-ol |
| PubChem CID | 104732049 |
| Molecular Formula | C10H14N4O |
| Molecular Weight | 206.25 g/mol |
| Exact Mass | 206.12 |
| IUPAC Name | 3-(pyrazolo[1,5-a]pyrazin-4-ylamino)butan-1-ol |
| SMILES | CC(CCO)Nc1nccn2nccc12 |
| InChI | InChI=1S/C10H14N4O/c1-8(3-7-15)13-10-9-2-4-12-14(9)6-5-11-10/h2,4-6,8,15H,3,7H2,1H3,(H,11,13) |
| InChIKey | PJRDYZPWKHFERS-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 62.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 206.25 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-(pyrazolo[1,5-a]pyrazin-4-ylamino)butan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(pyrazolo[1,5-a]pyrazin-4-ylamino)butan-1-ol?
The IUPAC name of 3-(pyrazolo[1,5-a]pyrazin-4-ylamino)butan-1-ol (CID 104732049) is 3-(pyrazolo[1,5-a]pyrazin-4-ylamino)butan-1-ol.
What is the SMILES notation for 3-(pyrazolo[1,5-a]pyrazin-4-ylamino)butan-1-ol?
The canonical SMILES for 3-(pyrazolo[1,5-a]pyrazin-4-ylamino)butan-1-ol is CC(CCO)Nc1nccn2nccc12.
What is the InChIKey of 3-(pyrazolo[1,5-a]pyrazin-4-ylamino)butan-1-ol?
The InChIKey is PJRDYZPWKHFERS-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14N4O/c1-8(3-7-15)13-10-9-2-4-12-14(9)6-5-11-10/h2,4-6,8,15H,3,7H2,1H3,(H,11,13).
What are the key properties of 3-(pyrazolo[1,5-a]pyrazin-4-ylamino)butan-1-ol?
3-(pyrazolo[1,5-a]pyrazin-4-ylamino)butan-1-ol has a molecular weight of 206.25 g/mol, XLogP of 0.91, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(pyrazolo[1,5-a]pyrazin-4-ylamino)butan-1-ol is sourced from PubChem (CID 104732049), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).