About 2-N-pyrazolo[1,5-a]pyrazin-4-ylbutane-1,2-diamine
2-N-pyrazolo[1,5-a]pyrazin-4-ylbutane-1,2-diamine (PubChem CID 104732618) has the molecular formula C10H15N5
and a molecular weight of 205.27 g/mol. Its IUPAC name is 2-N-pyrazolo[1,5-a]pyrazin-4-ylbutane-1,2-diamine.
Molecular Properties
| Compound Name | 2-N-pyrazolo[1,5-a]pyrazin-4-ylbutane-1,2-diamine |
| PubChem CID | 104732618 |
| Molecular Formula | C10H15N5 |
| Molecular Weight | 205.27 g/mol |
| Exact Mass | 205.13 |
| IUPAC Name | 2-N-pyrazolo[1,5-a]pyrazin-4-ylbutane-1,2-diamine |
| SMILES | CCC(CN)Nc1nccn2nccc12 |
| InChI | InChI=1S/C10H15N5/c1-2-8(7-11)14-10-9-3-4-13-15(9)6-5-12-10/h3-6,8H,2,7,11H2,1H3,(H,12,14) |
| InChIKey | HTEFTEUXPOJATP-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 68.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 205.27 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-N-pyrazolo[1,5-a]pyrazin-4-ylbutane-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-N-pyrazolo[1,5-a]pyrazin-4-ylbutane-1,2-diamine?
The IUPAC name of 2-N-pyrazolo[1,5-a]pyrazin-4-ylbutane-1,2-diamine (CID 104732618) is 2-N-pyrazolo[1,5-a]pyrazin-4-ylbutane-1,2-diamine.
What is the SMILES notation for 2-N-pyrazolo[1,5-a]pyrazin-4-ylbutane-1,2-diamine?
The canonical SMILES for 2-N-pyrazolo[1,5-a]pyrazin-4-ylbutane-1,2-diamine is CCC(CN)Nc1nccn2nccc12.
What is the InChIKey of 2-N-pyrazolo[1,5-a]pyrazin-4-ylbutane-1,2-diamine?
The InChIKey is HTEFTEUXPOJATP-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H15N5/c1-2-8(7-11)14-10-9-3-4-13-15(9)6-5-12-10/h3-6,8H,2,7,11H2,1H3,(H,12,14).
What are the key properties of 2-N-pyrazolo[1,5-a]pyrazin-4-ylbutane-1,2-diamine?
2-N-pyrazolo[1,5-a]pyrazin-4-ylbutane-1,2-diamine has a molecular weight of 205.27 g/mol, XLogP of 0.88, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-N-pyrazolo[1,5-a]pyrazin-4-ylbutane-1,2-diamine is sourced from PubChem (CID 104732618), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).